About 3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol
3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol (PubChem CID 135505751) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol.
Molecular Properties
| Compound Name | 3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol |
| PubChem CID | 135505751 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol |
| SMILES | Oc1[nH]c2cnccc2c1Cc1ccccc1 |
| InChI | InChI=1S/C14H12N2O/c17-14-12(8-10-4-2-1-3-5-10)11-6-7-15-9-13(11)16-14/h1-7,9,16-17H,8H2 |
| InChIKey | JQWADQPESIGHIK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol?
The IUPAC name of 3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol (CID 135505751) is 3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol.
What is the SMILES notation for 3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol?
The canonical SMILES for 3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol is Oc1[nH]c2cnccc2c1Cc1ccccc1.
What is the InChIKey of 3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol?
The InChIKey is JQWADQPESIGHIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O/c17-14-12(8-10-4-2-1-3-5-10)11-6-7-15-9-13(11)16-14/h1-7,9,16-17H,8H2.
What are the key properties of 3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol?
3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol has a molecular weight of 224.26 g/mol, XLogP of 2.86, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1H-pyrrolo[2,3-c]pyridin-2-ol is sourced from PubChem (CID 135505751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).