C11H7Br2ClN2 — CID 160546617
6,8-dibromo-9H-pyrido[3,4-b]indole;hydrochloride (PubChem CID 160546617) has the molecular formula C11H7Br2ClN2 and a molecular weight of 362.45 g/mol. Its IUPAC name is 6,8-dibromo-9H-pyrido[3,4-b]indole;hydrochloride.
| Compound Name | 6,8-dibromo-9H-pyrido[3,4-b]indole;hydrochloride |
|---|---|
| PubChem CID | 160546617 |
| Molecular Formula | C11H7Br2ClN2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 359.87 |
| IUPAC Name | 6,8-dibromo-9H-pyrido[3,4-b]indole;hydrochloride |
| SMILES | Brc1cc(Br)c2[nH]c3cnccc3c2c1.Cl |
| InChI | InChI=1S/C11H6Br2N2.ClH/c12-6-3-8-7-1-2-14-5-10(7)15-11(8)9(13)4-6;/h1-5,15H;1H |
| InChIKey | GCOJUFAYWCANJZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |