C16H10ClN3OS — CID 21362693
N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)thiophene-2-carboxamide (PubChem CID 21362693) has the molecular formula C16H10ClN3OS and a molecular weight of 327.80 g/mol. Its IUPAC name is N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)thiophene-2-carboxamide.
| Compound Name | N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 21362693 |
| Molecular Formula | C16H10ClN3OS |
| Molecular Weight | 327.80 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | N-(6-chloro-9H-pyrido[3,4-b]indol-8-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc2c1[nH]c1cnccc12)c1cccs1 |
| InChI | InChI=1S/C16H10ClN3OS/c17-9-6-11-10-3-4-18-8-13(10)19-15(11)12(7-9)20-16(21)14-2-1-5-22-14/h1-8,19H,(H,20,21) |
| InChIKey | YPVYZASEUDPIQN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.80 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |