C11H7ClFN3 — CID 59337538
6-chloro-4-fluoro-9H-pyrido[3,4-b]indol-8-amine (PubChem CID 59337538) has the molecular formula C11H7ClFN3 and a molecular weight of 235.65 g/mol. Its IUPAC name is 6-chloro-4-fluoro-9H-pyrido[3,4-b]indol-8-amine.
| Compound Name | 6-chloro-4-fluoro-9H-pyrido[3,4-b]indol-8-amine |
|---|---|
| PubChem CID | 59337538 |
| Molecular Formula | C11H7ClFN3 |
| Molecular Weight | 235.65 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 6-chloro-4-fluoro-9H-pyrido[3,4-b]indol-8-amine |
| SMILES | Nc1cc(Cl)cc2c1[nH]c1cncc(F)c12 |
| InChI | InChI=1S/C11H7ClFN3/c12-5-1-6-10-7(13)3-15-4-9(10)16-11(6)8(14)2-5/h1-4,16H,14H2 |
| InChIKey | PLUJCXMMYZUSOP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.65 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|