About 5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione
5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione (PubChem CID 166547715) has the molecular formula C7H4FN3O2
and a molecular weight of 181.13 g/mol. Its IUPAC name is 5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione |
| PubChem CID | 166547715 |
| Molecular Formula | C7H4FN3O2 |
| Molecular Weight | 181.13 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2c(F)cncc2[nH]1 |
| InChI | InChI=1S/C7H4FN3O2/c8-3-1-9-2-4-5(3)6(12)11-7(13)10-4/h1-2H,(H2,10,11,12,13) |
| InChIKey | XVOIQJKGGNJPHL-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.13 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione?
The IUPAC name of 5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione (CID 166547715) is 5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione.
What is the SMILES notation for 5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione?
The canonical SMILES for 5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione is O=c1[nH]c(=O)c2c(F)cncc2[nH]1.
What is the InChIKey of 5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione?
The InChIKey is XVOIQJKGGNJPHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FN3O2/c8-3-1-9-2-4-5(3)6(12)11-7(13)10-4/h1-2H,(H2,10,11,12,13).
What are the key properties of 5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione?
5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione has a molecular weight of 181.13 g/mol, XLogP of -0.25, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1H-pyrido[3,4-d]pyrimidine-2,4-dione is sourced from PubChem (CID 166547715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).