C11H5ClFN3O2 — CID 67165969
6-chloro-4-fluoro-8-nitro-9H-pyrido[3,4-b]indole (PubChem CID 67165969) has the molecular formula C11H5ClFN3O2 and a molecular weight of 265.63 g/mol. Its IUPAC name is 6-chloro-4-fluoro-8-nitro-9H-pyrido[3,4-b]indole.
| Compound Name | 6-chloro-4-fluoro-8-nitro-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 67165969 |
| Molecular Formula | C11H5ClFN3O2 |
| Molecular Weight | 265.63 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 6-chloro-4-fluoro-8-nitro-9H-pyrido[3,4-b]indole |
| SMILES | O=[N+]([O-])c1cc(Cl)cc2c1[nH]c1cncc(F)c12 |
| InChI | InChI=1S/C11H5ClFN3O2/c12-5-1-6-10-7(13)3-14-4-8(10)15-11(6)9(2-5)16(17)18/h1-4,15H |
| InChIKey | GXEDMZQPADTRGS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.63 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|