C13H6Cl2N2O3 — CID 154120208
1,6-dichloro-4-nitro-10H-acridin-9-one (PubChem CID 154120208) has the molecular formula C13H6Cl2N2O3 and a molecular weight of 309.11 g/mol. Its IUPAC name is 1,6-dichloro-4-nitro-10H-acridin-9-one.
| Compound Name | 1,6-dichloro-4-nitro-10H-acridin-9-one |
|---|---|
| PubChem CID | 154120208 |
| Molecular Formula | C13H6Cl2N2O3 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 1,6-dichloro-4-nitro-10H-acridin-9-one |
| SMILES | O=c1c2ccc(Cl)cc2[nH]c2c([N+](=O)[O-])ccc(Cl)c12 |
| InChI | InChI=1S/C13H6Cl2N2O3/c14-6-1-2-7-9(5-6)16-12-10(17(19)20)4-3-8(15)11(12)13(7)18/h1-5H,(H,16,18) |
| InChIKey | FWOIUVHJYOIYIH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|