C8H4F2N2O2 — CID 46211866
4,8-difluoro-3-hydroxy-1H-1,6-naphthyridin-2-one (PubChem CID 46211866) has the molecular formula C8H4F2N2O2 and a molecular weight of 198.13 g/mol. Its IUPAC name is 4,8-difluoro-3-hydroxy-1H-1,6-naphthyridin-2-one.
| Compound Name | 4,8-difluoro-3-hydroxy-1H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 46211866 |
| Molecular Formula | C8H4F2N2O2 |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 4,8-difluoro-3-hydroxy-1H-1,6-naphthyridin-2-one |
| SMILES | O=c1[nH]c2c(F)cncc2c(F)c1O |
| InChI | InChI=1S/C8H4F2N2O2/c9-4-2-11-1-3-5(10)7(13)8(14)12-6(3)4/h1-2,13H,(H,12,14) |
| InChIKey | RRRWYJYEAGCYQH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |