C9H8FN3O — CID 166139788
N-[(7-fluoro-1H-pyrrolo[3,2-c]pyridin-2-yl)methyl]formamide (PubChem CID 166139788) has the molecular formula C9H8FN3O and a molecular weight of 193.18 g/mol. Its IUPAC name is N-[(7-fluoro-1H-pyrrolo[3,2-c]pyridin-2-yl)methyl]formamide.
| Compound Name | N-[(7-fluoro-1H-pyrrolo[3,2-c]pyridin-2-yl)methyl]formamide |
|---|---|
| PubChem CID | 166139788 |
| Molecular Formula | C9H8FN3O |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | N-[(7-fluoro-1H-pyrrolo[3,2-c]pyridin-2-yl)methyl]formamide |
| SMILES | O=CNCc1cc2cncc(F)c2[nH]1 |
| InChI | InChI=1S/C9H8FN3O/c10-8-4-11-2-6-1-7(3-12-5-14)13-9(6)8/h1-2,4-5,13H,3H2,(H,12,14) |
| InChIKey | WPXCUQVSZIOTNI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|