C12H8F4N4O — CID 122489027
N-[[5-fluoro-2-[2-(trifluoromethyl)pyrimidin-5-yl]-4-pyridinyl]methyl]formamide (PubChem CID 122489027) has the molecular formula C12H8F4N4O and a molecular weight of 300.22 g/mol. Its IUPAC name is N-[[5-fluoro-2-[2-(trifluoromethyl)pyrimidin-5-yl]-4-pyridinyl]methyl]formamide.
| Compound Name | N-[[5-fluoro-2-[2-(trifluoromethyl)pyrimidin-5-yl]-4-pyridinyl]methyl]formamide |
|---|---|
| PubChem CID | 122489027 |
| Molecular Formula | C12H8F4N4O |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | N-[[5-fluoro-2-[2-(trifluoromethyl)pyrimidin-5-yl]-4-pyridinyl]methyl]formamide |
| SMILES | O=CNCc1cc(-c2cnc(C(F)(F)F)nc2)ncc1F |
| InChI | InChI=1S/C12H8F4N4O/c13-9-5-18-10(1-7(9)2-17-6-21)8-3-19-11(20-4-8)12(14,15)16/h1,3-6H,2H2,(H,17,21) |
| InChIKey | XVBYPHBUBHGNEX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|