C13H11F3N4O2 — CID 139563976
N-[[5-methoxy-4-[2-(trifluoromethyl)pyrimidin-5-yl]-2-pyridinyl]methyl]formamide (PubChem CID 139563976) has the molecular formula C13H11F3N4O2 and a molecular weight of 312.25 g/mol. Its IUPAC name is N-[[5-methoxy-4-[2-(trifluoromethyl)pyrimidin-5-yl]-2-pyridinyl]methyl]formamide.
| Compound Name | N-[[5-methoxy-4-[2-(trifluoromethyl)pyrimidin-5-yl]-2-pyridinyl]methyl]formamide |
|---|---|
| PubChem CID | 139563976 |
| Molecular Formula | C13H11F3N4O2 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-[[5-methoxy-4-[2-(trifluoromethyl)pyrimidin-5-yl]-2-pyridinyl]methyl]formamide |
| SMILES | COc1cnc(CNC=O)cc1-c1cnc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C13H11F3N4O2/c1-22-11-6-18-9(5-17-7-21)2-10(11)8-3-19-12(20-4-8)13(14,15)16/h2-4,6-7H,5H2,1H3,(H,17,21) |
| InChIKey | ZAQPNXQSQZVGBV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|