C11H8F5N5O — CID 122489470
N-[[3-(difluoromethyl)-1-[2-(trifluoromethyl)pyrimidin-5-yl]pyrazol-4-yl]methyl]formamide (PubChem CID 122489470) has the molecular formula C11H8F5N5O and a molecular weight of 321.21 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)-1-[2-(trifluoromethyl)pyrimidin-5-yl]pyrazol-4-yl]methyl]formamide.
| Compound Name | N-[[3-(difluoromethyl)-1-[2-(trifluoromethyl)pyrimidin-5-yl]pyrazol-4-yl]methyl]formamide |
|---|---|
| PubChem CID | 122489470 |
| Molecular Formula | C11H8F5N5O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-[[3-(difluoromethyl)-1-[2-(trifluoromethyl)pyrimidin-5-yl]pyrazol-4-yl]methyl]formamide |
| SMILES | O=CNCc1cn(-c2cnc(C(F)(F)F)nc2)nc1C(F)F |
| InChI | InChI=1S/C11H8F5N5O/c12-9(13)8-6(1-17-5-22)4-21(20-8)7-2-18-10(19-3-7)11(14,15)16/h2-5,9H,1H2,(H,17,22) |
| InChIKey | RIPPYRCJFLIARN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|