C12H9F5N2 — CID 134203398
3-(difluoromethyl)-4-methyl-1-[4-(trifluoromethyl)phenyl]pyrazole (PubChem CID 134203398) has the molecular formula C12H9F5N2 and a molecular weight of 276.21 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-methyl-1-[4-(trifluoromethyl)phenyl]pyrazole.
| Compound Name | 3-(difluoromethyl)-4-methyl-1-[4-(trifluoromethyl)phenyl]pyrazole |
|---|---|
| PubChem CID | 134203398 |
| Molecular Formula | C12H9F5N2 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-(difluoromethyl)-4-methyl-1-[4-(trifluoromethyl)phenyl]pyrazole |
| SMILES | Cc1cn(-c2ccc(C(F)(F)F)cc2)nc1C(F)F |
| InChI | InChI=1S/C12H9F5N2/c1-7-6-19(18-10(7)11(13)14)9-4-2-8(3-5-9)12(15,16)17/h2-6,11H,1H3 |
| InChIKey | DTHVSCRGGUYCEQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |