C19H17F3N2O — CID 174415280
4-[(4-methoxyphenyl)methyl]-3-methyl-1-[4-(trifluoromethyl)phenyl]pyrazole (PubChem CID 174415280) has the molecular formula C19H17F3N2O and a molecular weight of 346.35 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)methyl]-3-methyl-1-[4-(trifluoromethyl)phenyl]pyrazole.
| Compound Name | 4-[(4-methoxyphenyl)methyl]-3-methyl-1-[4-(trifluoromethyl)phenyl]pyrazole |
|---|---|
| PubChem CID | 174415280 |
| Molecular Formula | C19H17F3N2O |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 4-[(4-methoxyphenyl)methyl]-3-methyl-1-[4-(trifluoromethyl)phenyl]pyrazole |
| SMILES | COc1ccc(Cc2cn(-c3ccc(C(F)(F)F)cc3)nc2C)cc1 |
| InChI | InChI=1S/C19H17F3N2O/c1-13-15(11-14-3-9-18(25-2)10-4-14)12-24(23-13)17-7-5-16(6-8-17)19(20,21)22/h3-10,12H,11H2,1-2H3 |
| InChIKey | FGHNZLDHFVMEAV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |