About 5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline
5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline (PubChem CID 70345399) has the molecular formula C26H20F3N3O
and a molecular weight of 447.46 g/mol. Its IUPAC name is 5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline.
Molecular Properties
| Compound Name | 5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline |
| PubChem CID | 70345399 |
| Molecular Formula | C26H20F3N3O |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline |
| SMILES | COc1ccc(CCc2nc3cn(-c4ccc(C(F)(F)F)cc4)nc3c3ccccc23)cc1 |
| InChI | InChI=1S/C26H20F3N3O/c1-33-20-13-6-17(7-14-20)8-15-23-21-4-2-3-5-22(21)25-24(30-23)16-32(31-25)19-11-9-18(10-12-19)26(27,28)29/h2-7,9-14,16H,8,15H2,1H3 |
| InChIKey | BYSDXCPKEFLOSW-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline?
The IUPAC name of 5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline (CID 70345399) is 5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline.
What is the SMILES notation for 5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline?
The canonical SMILES for 5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline is COc1ccc(CCc2nc3cn(-c4ccc(C(F)(F)F)cc4)nc3c3ccccc23)cc1.
What is the InChIKey of 5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline?
The InChIKey is BYSDXCPKEFLOSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20F3N3O/c1-33-20-13-6-17(7-14-20)8-15-23-21-4-2-3-5-22(21)25-24(30-23)16-32(31-25)19-11-9-18(10-12-19)26(27,28)29/h2-7,9-14,16H,8,15H2,1H3.
What are the key properties of 5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline?
5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline has a molecular weight of 447.46 g/mol, XLogP of 6.39, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-methoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]pyrazolo[4,3-c]isoquinoline is sourced from PubChem (CID 70345399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).