C12H8F6N4 — CID 122490195
[5-(trifluoromethyl)-4-[2-(trifluoromethyl)pyrimidin-5-yl]-2-pyridinyl]methanamine (PubChem CID 122490195) has the molecular formula C12H8F6N4 and a molecular weight of 322.21 g/mol. Its IUPAC name is [5-(trifluoromethyl)-4-[2-(trifluoromethyl)pyrimidin-5-yl]-2-pyridinyl]methanamine.
| Compound Name | [5-(trifluoromethyl)-4-[2-(trifluoromethyl)pyrimidin-5-yl]-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 122490195 |
| Molecular Formula | C12H8F6N4 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | [5-(trifluoromethyl)-4-[2-(trifluoromethyl)pyrimidin-5-yl]-2-pyridinyl]methanamine |
| SMILES | NCc1cc(-c2cnc(C(F)(F)F)nc2)c(C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H8F6N4/c13-11(14,15)9-5-20-7(2-19)1-8(9)6-3-21-10(22-4-6)12(16,17)18/h1,3-5H,2,19H2 |
| InChIKey | YLMQRCVNUQPDPH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |