C13H9F6N3 — CID 122490208
[2-(trifluoromethyl)-5-[2-(trifluoromethyl)pyrimidin-5-yl]phenyl]methanamine (PubChem CID 122490208) has the molecular formula C13H9F6N3 and a molecular weight of 321.22 g/mol. Its IUPAC name is [2-(trifluoromethyl)-5-[2-(trifluoromethyl)pyrimidin-5-yl]phenyl]methanamine.
| Compound Name | [2-(trifluoromethyl)-5-[2-(trifluoromethyl)pyrimidin-5-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 122490208 |
| Molecular Formula | C13H9F6N3 |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | [2-(trifluoromethyl)-5-[2-(trifluoromethyl)pyrimidin-5-yl]phenyl]methanamine |
| SMILES | NCc1cc(-c2cnc(C(F)(F)F)nc2)ccc1C(F)(F)F |
| InChI | InChI=1S/C13H9F6N3/c14-12(15,16)10-2-1-7(3-8(10)4-20)9-5-21-11(22-6-9)13(17,18)19/h1-3,5-6H,4,20H2 |
| InChIKey | WXDZTLTYGXROTE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |