C8H10N2O — CID 142430826
N-[(5-methyl-3-pyridinyl)methyl]formamide (PubChem CID 142430826) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is N-[(5-methyl-3-pyridinyl)methyl]formamide.
| Compound Name | N-[(5-methyl-3-pyridinyl)methyl]formamide |
|---|---|
| PubChem CID | 142430826 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | N-[(5-methyl-3-pyridinyl)methyl]formamide |
| SMILES | Cc1cncc(CNC=O)c1 |
| InChI | InChI=1S/C8H10N2O/c1-7-2-8(4-9-3-7)5-10-6-11/h2-4,6H,5H2,1H3,(H,10,11) |
| InChIKey | WJJXCYNVEZXMBO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|