C9H15N3 — CID 102881007
1,1-dimethyl-2-[(5-methyl-3-pyridinyl)methyl]hydrazine (PubChem CID 102881007) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 1,1-dimethyl-2-[(5-methyl-3-pyridinyl)methyl]hydrazine.
| Compound Name | 1,1-dimethyl-2-[(5-methyl-3-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 102881007 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1,1-dimethyl-2-[(5-methyl-3-pyridinyl)methyl]hydrazine |
| SMILES | Cc1cncc(CNN(C)C)c1 |
| InChI | InChI=1S/C9H15N3/c1-8-4-9(6-10-5-8)7-11-12(2)3/h4-6,11H,7H2,1-3H3 |
| InChIKey | RNUUURFYXHTAGM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|