C15H17BrN2 — CID 102794730
(1R)-1-(4-bromophenyl)-N-[(5-methyl-3-pyridinyl)methyl]ethanamine (PubChem CID 102794730) has the molecular formula C15H17BrN2 and a molecular weight of 305.22 g/mol. Its IUPAC name is (1R)-1-(4-bromophenyl)-N-[(5-methyl-3-pyridinyl)methyl]ethanamine.
| Compound Name | (1R)-1-(4-bromophenyl)-N-[(5-methyl-3-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 102794730 |
| Molecular Formula | C15H17BrN2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (1R)-1-(4-bromophenyl)-N-[(5-methyl-3-pyridinyl)methyl]ethanamine |
| SMILES | Cc1cncc(CN[C@H](C)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C15H17BrN2/c1-11-7-13(9-17-8-11)10-18-12(2)14-3-5-15(16)6-4-14/h3-9,12,18H,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | PNJXKBSRAOCSMN-GFCCVEGCSA-N |
| XLogP | 4.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |