C15H16BrNO2 — CID 81353571
4-[[[(1R)-1-(4-bromophenyl)ethyl]amino]methyl]benzene-1,2-diol (PubChem CID 81353571) has the molecular formula C15H16BrNO2 and a molecular weight of 322.20 g/mol. Its IUPAC name is 4-[[[(1R)-1-(4-bromophenyl)ethyl]amino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[[(1R)-1-(4-bromophenyl)ethyl]amino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 81353571 |
| Molecular Formula | C15H16BrNO2 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 4-[[[(1R)-1-(4-bromophenyl)ethyl]amino]methyl]benzene-1,2-diol |
| SMILES | C[C@@H](NCc1ccc(O)c(O)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H16BrNO2/c1-10(12-3-5-13(16)6-4-12)17-9-11-2-7-14(18)15(19)8-11/h2-8,10,17-19H,9H2,1H3/t10-/m1/s1 |
| InChIKey | PZXCYZDKJQNPOO-SNVBAGLBSA-N |
| XLogP | 3.71 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|