C15H14BrF2NO — CID 81359778
4-[[[(1S)-1-(4-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol (PubChem CID 81359778) has the molecular formula C15H14BrF2NO and a molecular weight of 342.18 g/mol. Its IUPAC name is 4-[[[(1S)-1-(4-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol.
| Compound Name | 4-[[[(1S)-1-(4-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 81359778 |
| Molecular Formula | C15H14BrF2NO |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 4-[[[(1S)-1-(4-bromophenyl)ethyl]amino]methyl]-2,6-difluorophenol |
| SMILES | C[C@H](NCc1cc(F)c(O)c(F)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H14BrF2NO/c1-9(11-2-4-12(16)5-3-11)19-8-10-6-13(17)15(20)14(18)7-10/h2-7,9,19-20H,8H2,1H3/t9-/m0/s1 |
| InChIKey | PUFLWZBGZAMRSV-VIFPVBQESA-N |
| XLogP | 4.28 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |