C10H13ClN2 — CID 102881049
2-chloro-N-[(5-methyl-3-pyridinyl)methyl]prop-2-en-1-amine (PubChem CID 102881049) has the molecular formula C10H13ClN2 and a molecular weight of 196.68 g/mol. Its IUPAC name is 2-chloro-N-[(5-methyl-3-pyridinyl)methyl]prop-2-en-1-amine.
| Compound Name | 2-chloro-N-[(5-methyl-3-pyridinyl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 102881049 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-chloro-N-[(5-methyl-3-pyridinyl)methyl]prop-2-en-1-amine |
| SMILES | C=C(Cl)CNCc1cncc(C)c1 |
| InChI | InChI=1S/C10H13ClN2/c1-8-3-10(6-12-4-8)7-13-5-9(2)11/h3-4,6,13H,2,5,7H2,1H3 |
| InChIKey | QBQGKKVYTWWTKS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |