C14H23ClN2 — CID 106140789
5-chloro-2,2-dimethyl-N-[(5-methyl-3-pyridinyl)methyl]pentan-1-amine (PubChem CID 106140789) has the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. Its IUPAC name is 5-chloro-2,2-dimethyl-N-[(5-methyl-3-pyridinyl)methyl]pentan-1-amine.
| Compound Name | 5-chloro-2,2-dimethyl-N-[(5-methyl-3-pyridinyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 106140789 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 5-chloro-2,2-dimethyl-N-[(5-methyl-3-pyridinyl)methyl]pentan-1-amine |
| SMILES | Cc1cncc(CNCC(C)(C)CCCCl)c1 |
| InChI | InChI=1S/C14H23ClN2/c1-12-7-13(9-16-8-12)10-17-11-14(2,3)5-4-6-15/h7-9,17H,4-6,10-11H2,1-3H3 |
| InChIKey | ZSHYVKLSMYDJSD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|