C14H22ClN — CID 106140086
4-chloro-2,2-dimethyl-N-[(3-methylphenyl)methyl]butan-1-amine (PubChem CID 106140086) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is 4-chloro-2,2-dimethyl-N-[(3-methylphenyl)methyl]butan-1-amine.
| Compound Name | 4-chloro-2,2-dimethyl-N-[(3-methylphenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 106140086 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 4-chloro-2,2-dimethyl-N-[(3-methylphenyl)methyl]butan-1-amine |
| SMILES | Cc1cccc(CNCC(C)(C)CCCl)c1 |
| InChI | InChI=1S/C14H22ClN/c1-12-5-4-6-13(9-12)10-16-11-14(2,3)7-8-15/h4-6,9,16H,7-8,10-11H2,1-3H3 |
| InChIKey | QYMMVSGTWHHRTB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|