C13H18BrClFN — CID 106140108
N-[(3-bromo-4-fluorophenyl)methyl]-4-chloro-2,2-dimethylbutan-1-amine (PubChem CID 106140108) has the molecular formula C13H18BrClFN and a molecular weight of 322.65 g/mol. Its IUPAC name is N-[(3-bromo-4-fluorophenyl)methyl]-4-chloro-2,2-dimethylbutan-1-amine.
| Compound Name | N-[(3-bromo-4-fluorophenyl)methyl]-4-chloro-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 106140108 |
| Molecular Formula | C13H18BrClFN |
| Molecular Weight | 322.65 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | N-[(3-bromo-4-fluorophenyl)methyl]-4-chloro-2,2-dimethylbutan-1-amine |
| SMILES | CC(C)(CCCl)CNCc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H18BrClFN/c1-13(2,5-6-15)9-17-8-10-3-4-12(16)11(14)7-10/h3-4,7,17H,5-6,8-9H2,1-2H3 |
| InChIKey | BKIWHLQGKITWCL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.65 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|