C11H16BrFN2 — CID 107951053
N'-[(3-bromo-4-fluorophenyl)methyl]-N-ethylethane-1,2-diamine (PubChem CID 107951053) has the molecular formula C11H16BrFN2 and a molecular weight of 275.16 g/mol. Its IUPAC name is N'-[(3-bromo-4-fluorophenyl)methyl]-N-ethylethane-1,2-diamine.
| Compound Name | N'-[(3-bromo-4-fluorophenyl)methyl]-N-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 107951053 |
| Molecular Formula | C11H16BrFN2 |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | N'-[(3-bromo-4-fluorophenyl)methyl]-N-ethylethane-1,2-diamine |
| SMILES | CCNCCNCc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H16BrFN2/c1-2-14-5-6-15-8-9-3-4-11(13)10(12)7-9/h3-4,7,14-15H,2,5-6,8H2,1H3 |
| InChIKey | PQZIOMJAAZMPBK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|