C11H14BrClFN — CID 106844249
N-[(3-bromo-4-fluorophenyl)methyl]-4-chlorobutan-1-amine (PubChem CID 106844249) has the molecular formula C11H14BrClFN and a molecular weight of 294.59 g/mol. Its IUPAC name is N-[(3-bromo-4-fluorophenyl)methyl]-4-chlorobutan-1-amine.
| Compound Name | N-[(3-bromo-4-fluorophenyl)methyl]-4-chlorobutan-1-amine |
|---|---|
| PubChem CID | 106844249 |
| Molecular Formula | C11H14BrClFN |
| Molecular Weight | 294.59 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | N-[(3-bromo-4-fluorophenyl)methyl]-4-chlorobutan-1-amine |
| SMILES | Fc1ccc(CNCCCCCl)cc1Br |
| InChI | InChI=1S/C11H14BrClFN/c12-10-7-9(3-4-11(10)14)8-15-6-2-1-5-13/h3-4,7,15H,1-2,5-6,8H2 |
| InChIKey | WBMIBGDOYBXVKK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|