C13H17BrFN — CID 115639618
N-[(3-bromo-4-fluorophenyl)methyl]-3-cyclopropylpropan-1-amine (PubChem CID 115639618) has the molecular formula C13H17BrFN and a molecular weight of 286.19 g/mol. Its IUPAC name is N-[(3-bromo-4-fluorophenyl)methyl]-3-cyclopropylpropan-1-amine.
| Compound Name | N-[(3-bromo-4-fluorophenyl)methyl]-3-cyclopropylpropan-1-amine |
|---|---|
| PubChem CID | 115639618 |
| Molecular Formula | C13H17BrFN |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | N-[(3-bromo-4-fluorophenyl)methyl]-3-cyclopropylpropan-1-amine |
| SMILES | Fc1ccc(CNCCCC2CC2)cc1Br |
| InChI | InChI=1S/C13H17BrFN/c14-12-8-11(5-6-13(12)15)9-16-7-1-2-10-3-4-10/h5-6,8,10,16H,1-4,7,9H2 |
| InChIKey | QBCXCIFEGAQPGO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|