C10H4F6N2O2 — CID 166453206
5,7-bis(trifluoromethyl)-1H-quinazoline-2,4-dione (PubChem CID 166453206) has the molecular formula C10H4F6N2O2 and a molecular weight of 298.14 g/mol. Its IUPAC name is 5,7-bis(trifluoromethyl)-1H-quinazoline-2,4-dione.
| Compound Name | 5,7-bis(trifluoromethyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 166453206 |
| Molecular Formula | C10H4F6N2O2 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 5,7-bis(trifluoromethyl)-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2c(C(F)(F)F)cc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C10H4F6N2O2/c11-9(12,13)3-1-4(10(14,15)16)6-5(2-3)17-8(20)18-7(6)19/h1-2H,(H2,17,18,19,20) |
| InChIKey | XLAFORBYEQIPHN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |