C9H6ClF3N2O2 — CID 140995294
6-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione;hydrochloride (PubChem CID 140995294) has the molecular formula C9H6ClF3N2O2 and a molecular weight of 266.61 g/mol. Its IUPAC name is 6-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione;hydrochloride.
| Compound Name | 6-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 140995294 |
| Molecular Formula | C9H6ClF3N2O2 |
| Molecular Weight | 266.61 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 6-(trifluoromethyl)-1,4-dihydroquinoxaline-2,3-dione;hydrochloride |
| SMILES | Cl.O=c1[nH]c2ccc(C(F)(F)F)cc2[nH]c1=O |
| InChI | InChI=1S/C9H5F3N2O2.ClH/c10-9(11,12)4-1-2-5-6(3-4)14-8(16)7(15)13-5;/h1-3H,(H,13,15)(H,14,16);1H |
| InChIKey | ZZTZPERABZTDOR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.61 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|