C15H10F3N3O3-2 — CID 162128884
(2-oxo-1,3-dihydrobenzimidazol-5-yl)-[3-(trifluoromethyl)anilino]methanediolate (PubChem CID 162128884) has the molecular formula C15H10F3N3O3-2 and a molecular weight of 337.26 g/mol. Its IUPAC name is (2-oxo-1,3-dihydrobenzimidazol-5-yl)-[3-(trifluoromethyl)anilino]methanediolate.
| Compound Name | (2-oxo-1,3-dihydrobenzimidazol-5-yl)-[3-(trifluoromethyl)anilino]methanediolate |
|---|---|
| PubChem CID | 162128884 |
| Molecular Formula | C15H10F3N3O3-2 |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (2-oxo-1,3-dihydrobenzimidazol-5-yl)-[3-(trifluoromethyl)anilino]methanediolate |
| SMILES | O=c1[nH]c2ccc(C([O-])([O-])Nc3cccc(C(F)(F)F)c3)cc2[nH]1 |
| InChI | InChI=1S/C15H10F3N3O3/c16-14(17,18)8-2-1-3-10(6-8)21-15(23,24)9-4-5-11-12(7-9)20-13(22)19-11/h1-7,21H,(H2,19,20,22)/q-2 |
| InChIKey | ZIKCMXMAJFJXJT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 106.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|