C14H9F3N2OS — CID 86342396
6-[3-(trifluoromethyl)anilino]-3H-1,3-benzothiazol-2-one (PubChem CID 86342396) has the molecular formula C14H9F3N2OS and a molecular weight of 310.30 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)anilino]-3H-1,3-benzothiazol-2-one.
| Compound Name | 6-[3-(trifluoromethyl)anilino]-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 86342396 |
| Molecular Formula | C14H9F3N2OS |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 6-[3-(trifluoromethyl)anilino]-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2ccc(Nc3cccc(C(F)(F)F)c3)cc2s1 |
| InChI | InChI=1S/C14H9F3N2OS/c15-14(16,17)8-2-1-3-9(6-8)18-10-4-5-11-12(7-10)21-13(20)19-11/h1-7,18H,(H,19,20) |
| InChIKey | FDQUDHDFGFXQMZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |