C29H19Cl2F3N2O — CID 118329978
6-[bis(4-chlorophenyl)methyl]-4-[3-(trifluoromethyl)anilino]-1H-quinolin-2-one (PubChem CID 118329978) has the molecular formula C29H19Cl2F3N2O and a molecular weight of 539.38 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-4-[3-(trifluoromethyl)anilino]-1H-quinolin-2-one.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-4-[3-(trifluoromethyl)anilino]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 118329978 |
| Molecular Formula | C29H19Cl2F3N2O |
| Molecular Weight | 539.38 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-4-[3-(trifluoromethyl)anilino]-1H-quinolin-2-one |
| SMILES | O=c1cc(Nc2cccc(C(F)(F)F)c2)c2cc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)ccc2[nH]1 |
| InChI | InChI=1S/C29H19Cl2F3N2O/c30-21-9-4-17(5-10-21)28(18-6-11-22(31)12-7-18)19-8-13-25-24(14-19)26(16-27(37)36-25)35-23-3-1-2-20(15-23)29(32,33)34/h1-16,28H,(H2,35,36,37) |
| InChIKey | NIJKIUUJXYMQLS-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.38 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|