C17H12F3NO2 — CID 157261147
4-hydroxy-6-[[3-(trifluoromethyl)phenyl]methyl]-1H-quinolin-2-one (PubChem CID 157261147) has the molecular formula C17H12F3NO2 and a molecular weight of 319.28 g/mol. Its IUPAC name is 4-hydroxy-6-[[3-(trifluoromethyl)phenyl]methyl]-1H-quinolin-2-one.
| Compound Name | 4-hydroxy-6-[[3-(trifluoromethyl)phenyl]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 157261147 |
| Molecular Formula | C17H12F3NO2 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4-hydroxy-6-[[3-(trifluoromethyl)phenyl]methyl]-1H-quinolin-2-one |
| SMILES | O=c1cc(O)c2cc(Cc3cccc(C(F)(F)F)c3)ccc2[nH]1 |
| InChI | InChI=1S/C17H12F3NO2/c18-17(19,20)12-3-1-2-10(7-12)6-11-4-5-14-13(8-11)15(22)9-16(23)21-14/h1-5,7-9H,6H2,(H2,21,22,23) |
| InChIKey | AXLVMFHDMVPNFU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |