C19H15F2NO2 — CID 142967265
4-[[4-(1,1-difluoroethyl)-2-oxo-1H-quinolin-6-yl]methyl]benzaldehyde (PubChem CID 142967265) has the molecular formula C19H15F2NO2 and a molecular weight of 327.33 g/mol. Its IUPAC name is 4-[[4-(1,1-difluoroethyl)-2-oxo-1H-quinolin-6-yl]methyl]benzaldehyde.
| Compound Name | 4-[[4-(1,1-difluoroethyl)-2-oxo-1H-quinolin-6-yl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 142967265 |
| Molecular Formula | C19H15F2NO2 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 4-[[4-(1,1-difluoroethyl)-2-oxo-1H-quinolin-6-yl]methyl]benzaldehyde |
| SMILES | CC(F)(F)c1cc(=O)[nH]c2ccc(Cc3ccc(C=O)cc3)cc12 |
| InChI | InChI=1S/C19H15F2NO2/c1-19(20,21)16-10-18(24)22-17-7-6-14(9-15(16)17)8-12-2-4-13(11-23)5-3-12/h2-7,9-11H,8H2,1H3,(H,22,24) |
| InChIKey | RYBABGLMWOGAGL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|