C15H14F3NO — CID 90954001
6-pent-2-en-2-yl-4-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 90954001) has the molecular formula C15H14F3NO and a molecular weight of 281.28 g/mol. Its IUPAC name is 6-pent-2-en-2-yl-4-(trifluoromethyl)-1H-quinolin-2-one.
| Compound Name | 6-pent-2-en-2-yl-4-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 90954001 |
| Molecular Formula | C15H14F3NO |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 6-pent-2-en-2-yl-4-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | CCC=C(C)c1ccc2[nH]c(=O)cc(C(F)(F)F)c2c1 |
| InChI | InChI=1S/C15H14F3NO/c1-3-4-9(2)10-5-6-13-11(7-10)12(15(16,17)18)8-14(20)19-13/h4-8H,3H2,1-2H3,(H,19,20) |
| InChIKey | PRBDKAMFZXOIOK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |