C12H13F3N2O — CID 142046924
6-amino-4-(trifluoromethyl)-1H-quinolin-2-one;ethane (PubChem CID 142046924) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is 6-amino-4-(trifluoromethyl)-1H-quinolin-2-one;ethane.
| Compound Name | 6-amino-4-(trifluoromethyl)-1H-quinolin-2-one;ethane |
|---|---|
| PubChem CID | 142046924 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 6-amino-4-(trifluoromethyl)-1H-quinolin-2-one;ethane |
| SMILES | CC.Nc1ccc2[nH]c(=O)cc(C(F)(F)F)c2c1 |
| InChI | InChI=1S/C10H7F3N2O.C2H6/c11-10(12,13)7-4-9(16)15-8-2-1-5(14)3-6(7)8;1-2/h1-4H,14H2,(H,15,16);1-2H3 |
| InChIKey | ONXPRUQJUYVCLP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|