C22H21F3N2O3S — CID 10072453
6-[(4-piperidin-1-ylsulfonylphenyl)methyl]-4-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 10072453) has the molecular formula C22H21F3N2O3S and a molecular weight of 450.48 g/mol. Its IUPAC name is 6-[(4-piperidin-1-ylsulfonylphenyl)methyl]-4-(trifluoromethyl)-1H-quinolin-2-one.
| Compound Name | 6-[(4-piperidin-1-ylsulfonylphenyl)methyl]-4-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10072453 |
| Molecular Formula | C22H21F3N2O3S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 6-[(4-piperidin-1-ylsulfonylphenyl)methyl]-4-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | O=c1cc(C(F)(F)F)c2cc(Cc3ccc(S(=O)(=O)N4CCCCC4)cc3)ccc2[nH]1 |
| InChI | InChI=1S/C22H21F3N2O3S/c23-22(24,25)19-14-21(28)26-20-9-6-16(13-18(19)20)12-15-4-7-17(8-5-15)31(29,30)27-10-2-1-3-11-27/h4-9,13-14H,1-3,10-12H2,(H,26,28) |
| InChIKey | YTSNEMINRNGOET-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |