C18H16F3N5O3S — CID 22055302
6-(4-pyrazin-2-ylpiperazin-1-yl)sulfonyl-4-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 22055302) has the molecular formula C18H16F3N5O3S and a molecular weight of 439.42 g/mol. Its IUPAC name is 6-(4-pyrazin-2-ylpiperazin-1-yl)sulfonyl-4-(trifluoromethyl)-1H-quinolin-2-one.
| Compound Name | 6-(4-pyrazin-2-ylpiperazin-1-yl)sulfonyl-4-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 22055302 |
| Molecular Formula | C18H16F3N5O3S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 6-(4-pyrazin-2-ylpiperazin-1-yl)sulfonyl-4-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | O=c1cc(C(F)(F)F)c2cc(S(=O)(=O)N3CCN(c4cnccn4)CC3)ccc2[nH]1 |
| InChI | InChI=1S/C18H16F3N5O3S/c19-18(20,21)14-10-17(27)24-15-2-1-12(9-13(14)15)30(28,29)26-7-5-25(6-8-26)16-11-22-3-4-23-16/h1-4,9-11H,5-8H2,(H,24,27) |
| InChIKey | FXVQQILQWPIAKS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |