C14H14Cl2N4O3S — CID 23962785
2,4-dichloro-6-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenol (PubChem CID 23962785) has the molecular formula C14H14Cl2N4O3S and a molecular weight of 389.26 g/mol. Its IUPAC name is 2,4-dichloro-6-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenol.
| Compound Name | 2,4-dichloro-6-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenol |
|---|---|
| PubChem CID | 23962785 |
| Molecular Formula | C14H14Cl2N4O3S |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 2,4-dichloro-6-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenol |
| SMILES | O=S(=O)(c1cc(Cl)cc(Cl)c1O)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C14H14Cl2N4O3S/c15-10-7-11(16)14(21)12(8-10)24(22,23)20-5-3-19(4-6-20)13-9-17-1-2-18-13/h1-2,7-9,21H,3-6H2 |
| InChIKey | CTFRITZNNLRQQA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|