C14H16N4O4S2 — CID 3709247
methyl 3-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylthiophene-2-carboxylate (PubChem CID 3709247) has the molecular formula C14H16N4O4S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is methyl 3-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 3709247 |
| Molecular Formula | C14H16N4O4S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | methyl 3-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C14H16N4O4S2/c1-22-14(19)13-11(2-9-23-13)24(20,21)18-7-5-17(6-8-18)12-10-15-3-4-16-12/h2-4,9-10H,5-8H2,1H3 |
| InChIKey | BIDWOYZDRHMAKJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |