C18H22N2O5S2 — CID 3796308
methyl 3-[4-(4-ethoxyphenyl)piperazin-1-yl]sulfonylthiophene-2-carboxylate (PubChem CID 3796308) has the molecular formula C18H22N2O5S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is methyl 3-[4-(4-ethoxyphenyl)piperazin-1-yl]sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-[4-(4-ethoxyphenyl)piperazin-1-yl]sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 3796308 |
| Molecular Formula | C18H22N2O5S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | methyl 3-[4-(4-ethoxyphenyl)piperazin-1-yl]sulfonylthiophene-2-carboxylate |
| SMILES | CCOc1ccc(N2CCN(S(=O)(=O)c3ccsc3C(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C18H22N2O5S2/c1-3-25-15-6-4-14(5-7-15)19-9-11-20(12-10-19)27(22,23)16-8-13-26-17(16)18(21)24-2/h4-8,13H,3,9-12H2,1-2H3 |
| InChIKey | DEXQOQWBZUGUSG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|