C16H18ClN5O3S — CID 42317830
2-chloro-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]acetamide (PubChem CID 42317830) has the molecular formula C16H18ClN5O3S and a molecular weight of 395.87 g/mol. Its IUPAC name is 2-chloro-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]acetamide.
| Compound Name | 2-chloro-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 42317830 |
| Molecular Formula | C16H18ClN5O3S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 2-chloro-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(S(=O)(=O)N2CCN(c3cnccn3)CC2)cc1 |
| InChI | InChI=1S/C16H18ClN5O3S/c17-11-16(23)20-13-1-3-14(4-2-13)26(24,25)22-9-7-21(8-10-22)15-12-18-5-6-19-15/h1-6,12H,7-11H2,(H,20,23) |
| InChIKey | LGFSPJIDHCICGH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|