C22H29N5O3S — CID 42317816
2-cyclohexyl-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]acetamide (PubChem CID 42317816) has the molecular formula C22H29N5O3S and a molecular weight of 443.57 g/mol. Its IUPAC name is 2-cyclohexyl-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]acetamide.
| Compound Name | 2-cyclohexyl-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 42317816 |
| Molecular Formula | C22H29N5O3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 2-cyclohexyl-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]acetamide |
| SMILES | O=C(CC1CCCCC1)Nc1ccc(S(=O)(=O)N2CCN(c3cnccn3)CC2)cc1 |
| InChI | InChI=1S/C22H29N5O3S/c28-22(16-18-4-2-1-3-5-18)25-19-6-8-20(9-7-19)31(29,30)27-14-12-26(13-15-27)21-17-23-10-11-24-21/h6-11,17-18H,1-5,12-16H2,(H,25,28) |
| InChIKey | KQFRKOWAYBDOPW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |