C23H25N5O5S — CID 42318009
2-(2-methoxyphenoxy)-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]acetamide (PubChem CID 42318009) has the molecular formula C23H25N5O5S and a molecular weight of 483.55 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]acetamide.
| Compound Name | 2-(2-methoxyphenoxy)-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 42318009 |
| Molecular Formula | C23H25N5O5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]acetamide |
| SMILES | COc1ccccc1OCC(=O)Nc1ccc(S(=O)(=O)N2CCN(c3cnccn3)CC2)cc1 |
| InChI | InChI=1S/C23H25N5O5S/c1-32-20-4-2-3-5-21(20)33-17-23(29)26-18-6-8-19(9-7-18)34(30,31)28-14-12-27(13-15-28)22-16-24-10-11-25-22/h2-11,16H,12-15,17H2,1H3,(H,26,29) |
| InChIKey | MMRGBQAUWCOZJK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |