C22H21F2N5O3S2 — CID 42318251
2-(difluoromethylsulfanyl)-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]benzamide (PubChem CID 42318251) has the molecular formula C22H21F2N5O3S2 and a molecular weight of 505.57 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]benzamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 42318251 |
| Molecular Formula | C22H21F2N5O3S2 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[4-(4-pyrazin-2-ylpiperazin-1-yl)sulfonylphenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCN(c3cnccn3)CC2)cc1)c1ccccc1SC(F)F |
| InChI | InChI=1S/C22H21F2N5O3S2/c23-22(24)33-19-4-2-1-3-18(19)21(30)27-16-5-7-17(8-6-16)34(31,32)29-13-11-28(12-14-29)20-15-25-9-10-26-20/h1-10,15,22H,11-14H2,(H,27,30) |
| InChIKey | NLUHBEIPICXBBI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |