C15H15F3N2O3S — CID 173231419
6-piperidin-1-ylsulfonyl-7-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 173231419) has the molecular formula C15H15F3N2O3S and a molecular weight of 360.36 g/mol. Its IUPAC name is 6-piperidin-1-ylsulfonyl-7-(trifluoromethyl)-1H-quinolin-2-one.
| Compound Name | 6-piperidin-1-ylsulfonyl-7-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 173231419 |
| Molecular Formula | C15H15F3N2O3S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 6-piperidin-1-ylsulfonyl-7-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | O=c1ccc2cc(S(=O)(=O)N3CCCCC3)c(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C15H15F3N2O3S/c16-15(17,18)11-9-12-10(4-5-14(21)19-12)8-13(11)24(22,23)20-6-2-1-3-7-20/h4-5,8-9H,1-3,6-7H2,(H,19,21) |
| InChIKey | SFFDFCUHWYCKFN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |