C15H19N3O4S — CID 20913976
6-(azepan-1-ylsulfonyl)-7-methyl-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 20913976) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is 6-(azepan-1-ylsulfonyl)-7-methyl-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-(azepan-1-ylsulfonyl)-7-methyl-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 20913976 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 6-(azepan-1-ylsulfonyl)-7-methyl-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2cc1S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C15H19N3O4S/c1-10-8-11-12(17-15(20)14(19)16-11)9-13(10)23(21,22)18-6-4-2-3-5-7-18/h8-9H,2-7H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | NPDWSORJQBUSOD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|