C15H15F3O — CID 107382752
3-[[3-(trifluoromethyl)phenyl]methyl]cyclohept-2-en-1-one (PubChem CID 107382752) has the molecular formula C15H15F3O and a molecular weight of 268.28 g/mol. Its IUPAC name is 3-[[3-(trifluoromethyl)phenyl]methyl]cyclohept-2-en-1-one.
| Compound Name | 3-[[3-(trifluoromethyl)phenyl]methyl]cyclohept-2-en-1-one |
|---|---|
| PubChem CID | 107382752 |
| Molecular Formula | C15H15F3O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3-[[3-(trifluoromethyl)phenyl]methyl]cyclohept-2-en-1-one |
| SMILES | O=C1C=C(Cc2cccc(C(F)(F)F)c2)CCCC1 |
| InChI | InChI=1S/C15H15F3O/c16-15(17,18)13-6-3-5-11(9-13)8-12-4-1-2-7-14(19)10-12/h3,5-6,9-10H,1-2,4,7-8H2 |
| InChIKey | JRGHARPAIAXPIM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |